Aliskiren hemifumarate is chemically called -N5amino-4hydroxy- 2,7-diisopropyl-8 [4-methoxy-3phenyl] -octanamide hemifumarate and its structural formula is: Molecular formula: C30H53N3O6 0. 5 C4H4O4 Aliskiren hemifumarate is a white to slightly yellowish crystalline powder with a molecular weight of 609. 8. High blood pressure adds to the work of the heart and arteries. If it proceeds for a lengthy time, the heart and arteries may not function correctly. This can harm the blood vessels of the brain, heart, and kidneys, leading to a stroke, cardiac arrest, or kidney failure. Lowering high blood pressure will decrease the risk of strokes and cardiac arrest. Aliskiren is a renin inhibitor. It works by obstructing an enzyme in the body that is essential to create a substance that causes blood vessels to tighten up. Because of this, the capillary relax and this decreases the blood pressure. When the high blood pressure is lowered, the amount of blood and oxygen that most likely to the heart is increased. This medication is offered only with your doctor's prescription.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
https://www.drugs.com/mtm/aliskiren.html
https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=41c0e5e0-eb26-4d9e-bcd2-d0f2cc8fc...
https://www.mayoclinic.org/drugs-supplements/aliskiren-oral-route/description/drg-20070895
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
5493444 | C30H53N3O6 | 551.8 | CC(C)C(CC1=CC(=C(C=C1)OC)OCCCOC)CC(C(CC(C(C)C)C(=O)NCC(C)(C)C(=O)N)O)N | CC(C)[[email protected]@H](CC1=CC(=C(C=C1)OC)OCCCOC)C[[email protected]@H]([[email protected]](C[[email protected]@H](C(C)C)C(=O)NCC(C)(C)C(=O)N)O)N | InChI=1S/C30H53N3O6/c1-19(2)22(14-21-10-11-26(38-8)27(15-21)39-13-9-12-37-7)16-24(31)25(34)17-23(20(3)4)28(35)33-18-30(5,6)29(32)36/h10-11,15,19-20,22-25,34H,9,12-14,16-18,31H2,1-8H3,(H2,32,36)(H,33,35)/t22-,23-,24-,25-/m0/s1 | UXOWGYHJODZGMF-QORCZRPOSA-N | (2S,4S,5S,7S)-5-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide | 3.5 | 551.39343642 | 551.39343642 | 146 | 717 | 0 | 4 | 7 | 19 | 39 | 0 | 4 | 4 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.
Contact
General contact: [email protected]