Antacids are medicines that counteract the acid in your stomach to relieve indigestion and heartburn. Antacids might assist if you have: acid indigestion; heartburn or indigestion, called gastro-oesophageal reflux disease; a stomach ulcer; gastritis. Talk with a general practitioner if you locate you require to take antacids consistently. Various types of antacid are readily available. Components to try to find include: aluminium hydroxide; magnesium carbonate; magnesium trisilicate; magnesium hydroxide; calcium carbonate; sodium bicarbonate. Some antacids contain other medicines, such as an alginate and simeticone.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
135353464 | C30H37N3O4 | 503.6 | COC1=CC=C(C=C1)CN2CC3(CCNCC3)C4=C(C2(CO)C(=O)C5CCC5)NC6=C4C=CC(=C6)OC | COC1=CC=C(C=C1)CN2CC3(CCNCC3)C4=C(C2(CO)C(=O)C5CCC5)NC6=C4C=CC(=C6)OC | InChI=1S/C30H37N3O4/c1-36-22-8-6-20(7-9-22)17-33-18-29(12-14-31-15-13-29)26-24-11-10-23(37-2)16-25(24)32-27(26)30(33,19-34)28(35)21-4-3-5-21/h6-11,16,21,31-32,34H,3-5,12-15,17-19H2,1-2H3 | RMHAFVTWOOWOMZ-UHFFFAOYSA-N | cyclobutyl-[1-(hydroxymethyl)-7-methoxy-2-[(4-methoxyphenyl)methyl]spiro[3,9-dihydropyrido[3,4-b]indole-4,4'-piperidine]-1-yl]methanone | 3.3 | 503.27840667 | 503.27840667 | 86.8 | 807 | 0 | 3 | 6 | 7 | 37 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.
Contact
General contact: [email protected]