A bacterial man-made chromosome is a crafted DNA molecule used to duplicate DNA sequences in bacterial cells. As the microbial cells grow and divide, they enhance the BAC DNA, which can then be separated and used in sequencing DNA. Each BAC is a DNA duplicate containing about 100 to 300 thousand base pairs of duplicated DNA. Since the BAC is much smaller than the endogenous bacterial chromosome, it is simple to purify the BAC DNA far from the remainder of the microorganisms cell's DNA, and therefore have the cloned DNA in a detoxified kind.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
54029194 | C6H14N2O3 | 162.19 | CC1C(C(C(C(O1)O)N)O)N | C[[email protected]@H]1[[email protected]]([[email protected]@H]([[email protected]](C(O1)O)N)O)N | InChI=1S/C6H14N2O3/c1-2-3(7)5(9)4(8)6(10)11-2/h2-6,9-10H,7-8H2,1H3/t2-,3-,4-,5+,6?/m1/s1 | LEJHBBPEPOZERQ-RSVSWTKNSA-N | (3R,4S,5S,6R)-3,5-diamino-6-methyloxane-2,4-diol | -2.6 | 162.10044231 | 162.10044231 | 102 | 144 | 0 | 4 | 5 | 0 | 11 | 0 | 5 | 4 | 1 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.
Contact
General contact: [email protected]