Get the current public health info from CDC and research information from NIH. A main internet site of the United States federal government. Federal government web sites often end in. gov or. mil. Prior to sharing delicate details, make sure you're on a federal government site. Chemical Effects in Biological Systems. Research Triangle Park, NC: National Toxicology Program.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
289 | C6H6O2 | 110.11 | C1=CC=C(C(=C1)O)O | C1=CC=C(C(=C1)O)O | InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H | YCIMNLLNPGFGHC-UHFFFAOYSA-N | benzene-1,2-diol | 0.9 | 110.036779430 | 110.036779430 | 40.5 | 62 | 0 | 2 | 2 | 0 | 8 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.