Chlorthalidone is a thiazide diuretic that aids prevent your body from absorbing way too much salt, which can cause liquid retention. It is 2-Chloro-5 benzenesulfonamide with the following structural formula: Chlorthalidone, USP is virtually insoluble in water, in ether, and in chloroform; soluble in methanol; somewhat soluble in ethanol. Chlorthalidone tablets are readily available having either 25 mg or 50 mg of chlorthalidone, USP and the following inactive ingredients: colloidal silicon dioxide, microcrystalline cellulose, pregelatinized starch, salt starch glycolate, stearic acid.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
https://www.mayoclinic.org/drugs-supplements/chlorthalidone-oral-route/description/drg-200...
https://www.drugs.com/mtm/chlorthalidone.html
https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=648f005f-1eae-4718-bc3a-2587d706f...
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
2732 | C14H11ClN2O4S | 338.8 | C1=CC=C2C(=C1)C(=O)NC2(C3=CC(=C(C=C3)Cl)S(=O)(=O)N)O | C1=CC=C2C(=C1)C(=O)NC2(C3=CC(=C(C=C3)Cl)S(=O)(=O)N)O | InChI=1S/C14H11ClN2O4S/c15-11-6-5-8(7-12(11)22(16,20)21)14(19)10-4-2-1-3-9(10)13(18)17-14/h1-7,19H,(H,17,18)(H2,16,20,21) | JIVPVXMEBJLZRO-UHFFFAOYSA-N | 2-chloro-5-(1-hydroxy-3-oxo-2H-isoindol-1-yl)benzenesulfonamide | 0.9 | 338.0128057 | 338.0128057 | 118 | 564 | 0 | 3 | 5 | 2 | 22 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.