Electric and magnetic fields, also called radiation, are areas of energy that surround electrical tools. All populations are now subjected to varying levels of EMF, and the degrees will remain to increase as modern technology breakthroughs. Electromagnetic radiation has been around since the birth of the cosmos; light is its most familiar kind. Electric and electromagnetic fields are part of the spectrum of electromagnetic radiation which extends from fixed electrical and magnetic fields, with radiofrequency and infrared radiation, to X-rays.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
https://medlineplus.gov/electromagneticfields.html
https://dceg.cancer.gov/research/public-health-impact/electromagnetic-fields
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
135277415 | C51H37NO | 679.8 | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)N(C4=CC=C(C=C4)C5=CC=CC=C5)C6=C(C=C7C8=CC=CC=C8OC7=C6)C9=CC=C(C=C9)C1=CC=CC=C1)C | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)N(C4=CC=C(C=C4)C5=CC=CC=C5)C6=C(C=C7C8=CC=CC=C8OC7=C6)C9=CC=C(C=C9)C1=CC=CC=C1)C | InChI=1S/C51H37NO/c1-51(2)46-19-11-9-17-41(46)42-30-29-40(31-47(42)51)52(39-27-25-37(26-28-39)35-15-7-4-8-16-35)48-33-50-45(43-18-10-12-20-49(43)53-50)32-44(48)38-23-21-36(22-24-38)34-13-5-3-6-14-34/h3-33H,1-2H3 | TZNWFNWITJQHPK-UHFFFAOYSA-N | N-(9,9-dimethylfluoren-2-yl)-N,2-bis(4-phenylphenyl)dibenzofuran-3-amine | 14.3 | 679.287514804 | 679.287514804 | 16.4 | 1180 | 0 | 0 | 2 | 6 | 53 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.