Ethacrynic acid is unsaturated ketone by-product of an aryloxyacetic acid. Ethacrynic acid is provided to help deal with liquid retention and swelling that is triggered by heart disease, liver disease, kidney disease, or other medical problems. It works by acting on the kidneys to increase the circulation of urine. This medicine is offered only with your physician's prescription.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
https://www.drugs.com/mtm/ethacrynic-acid.html
https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=409c9c72-0693-4d58-bcfe-e71567ed4...
https://www.mayoclinic.org/drugs-supplements/ethacrynic-acid-oral-route/description/drg-20...
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
3278 | C13H12Cl2O4 | 303.13 | CCC(=C)C(=O)C1=C(C(=C(C=C1)OCC(=O)O)Cl)Cl | CCC(=C)C(=O)C1=C(C(=C(C=C1)OCC(=O)O)Cl)Cl | InChI=1S/C13H12Cl2O4/c1-3-7(2)13(18)8-4-5-9(12(15)11(8)14)19-6-10(16)17/h4-5H,2-3,6H2,1H3,(H,16,17) | AVOLMBLBETYQHX-UHFFFAOYSA-N | 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid | 3.8 | 302.0112642 | 302.0112642 | 63.6 | 370 | 0 | 1 | 4 | 6 | 19 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.