Qbrexza cloth, 2. 4% is an anticholinergic drug offered as a clear, anemic to pale yellow remedy on a single-use pre-moistened cloth packaged in a pouch for topical administration. Each pouch contains 105 mg glycopyrronium tosylate, comparable to 66 mg of glycopyrronium. Glycopyrronium tosylate is chemically called pyrrolidinium, 3- [oxy] -1,1-dimethyl-, 4-methylbenzensulfonate, hydrate with an empirical formula of C26H37NO7S and a molecular weight of 507. 6.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=6b985380-1256-4fb3-b89a-6df2c6a6d...
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
3494 | C19H28NO3+ | 318.4 | C[N+]1(CCC(C1)OC(=O)C(C2CCCC2)(C3=CC=CC=C3)O)C | C[N+]1(CCC(C1)OC(=O)C(C2CCCC2)(C3=CC=CC=C3)O)C | InChI=1S/C19H28NO3/c1-20(2)13-12-17(14-20)23-18(21)19(22,16-10-6-7-11-16)15-8-4-3-5-9-15/h3-5,8-9,16-17,22H,6-7,10-14H2,1-2H3/q+1 | ANGKOCUUWGHLCE-UHFFFAOYSA-N | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-cyclopentyl-2-hydroxy-2-phenylacetate | 3.1 | 318.20691876 | 318.20691876 | 46.5 | 424 | 1 | 1 | 3 | 5 | 23 | 0 | 2 | 0 | 2 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.