At any time dark skin is reduced or burned, there's an increased risk of keloids - a mark that spreads out past the boundary of the original injury and develops into a development. Unlike other raised scars, keloids grow much bigger than the injury that created the mark. Keloid mark on the back of a hand. Not everyone who gets a mark will develop a keloid. If you have keloid-prone skin, nonetheless, anything that can cause a scar might lead to a keloid. This consists of a cut, burn, or extreme acne. Some people see a keloid after they puncture their ears or get a tattoo. A keloid can additionally form as chickenpox clear. In some cases, a medical mark becomes a keloid. In very uncommon cases, keloids develop when people do not hurt their skin. These are called spontaneous keloids. A keloid usually requires time to show up. After an injury, months can pass previously this mark shows up. A keloid can develop quicker. Once it starts, a keloid can enlarge gradually for years or months.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
https://medlineplus.gov/ency/article/000849.htm
https://www.aad.org/public/diseases/a-z/keloids-overview
https://www.webmd.com/skin-problems-and-treatments/keloids-directory
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
3828 | C14H12O5 | 260.24 | CC1=CC(=O)C2=C(C3=C(C(=C2O1)OC)OC=C3)OC | CC1=CC(=O)C2=C(C3=C(C(=C2O1)OC)OC=C3)OC | InChI=1S/C14H12O5/c1-7-6-9(15)10-11(16-2)8-4-5-18-12(8)14(17-3)13(10)19-7/h4-6H,1-3H3 | HSMPDPBYAYSOBC-UHFFFAOYSA-N | 4,9-dimethoxy-7-methylfuro[3,2-g]chromen-5-one | 2.3 | 260.06847348 | 260.06847348 | 57.9 | 405 | 0 | 0 | 5 | 2 | 19 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.
Contact
General contact: [email protected]