Minoxidil belongs to the basic class of medications called antihypertensives. High blood pressure may also increase the risk of heart attacks. These issues may be less likely to occur if blood pressure is managed. Minoxidil works by kicking back capillary to ensure that blood passes through them more quickly. Minoxidil has other effects that can be irritating for some patients. Minoxidil is being applied to the scalp in fluid type by some baldness men to boost hair development. Incorrect use of fluids made from minoxidil tablets can result in minoxidil being absorbed into the body, where it may cause undesirable effects on the heart and blood vessels.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
4201 | C9H15N5O | 209.25 | C1CCN(CC1)C2=NC(=N)N(C(=C2)N)O | C1CCN(CC1)C2=NC(=N)N(C(=C2)N)O | InChI=1S/C9H15N5O/c10-7-6-8(12-9(11)14(7)15)13-4-2-1-3-5-13/h6,11,15H,1-5,10H2 | ZIMGGGWCDYVHOY-UHFFFAOYSA-N | 3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine | 1.2 | 209.12766012 | 209.12766012 | 88.9 | 329 | 0 | 3 | 3 | 1 | 15 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.