The morning-after pill is a type of emergency birth control. Emergency situation birth control is used to protect against pregnancy for women who've had unsafe sex or whose contraception technique has failed. The morning-after pill is intended for backup birth control only, not as a primary technique of contraception. Morning-after pills can assist protect against maternity if you've had unprotected sex, either since you really did not use contraception, you missed out on a contraceptive pill, you were sexually attacked or your technique of contraception failed. Bear in mind that the morning-after pill isn't the same as mifepristone, additionally called RU-486 or the abortion pill.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
134224711 | C25H28F2N4O | 438.5 | CCC1=NN(C2=CC(=CC(=C21)CC(C)N3C4=C(C=C(C=C4)F)C(=N3)C(C)C)F)C5COC5 | CCC1=NN(C2=CC(=CC(=C21)CC(C)N3C4=C(C=C(C=C4)F)C(=N3)C(C)C)F)C5COC5 | InChI=1S/C25H28F2N4O/c1-5-21-24-16(9-18(27)11-23(24)31(28-21)19-12-32-13-19)8-15(4)30-22-7-6-17(26)10-20(22)25(29-30)14(2)3/h6-7,9-11,14-15,19H,5,8,12-13H2,1-4H3 | DARBVRNHICPRPE-UHFFFAOYSA-N | 3-ethyl-6-fluoro-4-[2-(5-fluoro-3-propan-2-ylindazol-1-yl)propyl]-1-(oxetan-3-yl)indazole | 5.3 | 438.22311785 | 438.22311785 | 44.9 | 649 | 0 | 0 | 5 | 6 | 32 | 0 | 1 | 0 | 1 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.