Pneumocystis jiroveci pneumonia is a fungal infection of the lungs. Cancer; Long-term use of corticosteroids or other medications that weaken the body immune system; HIV/AIDS; Organ or bone marrow transplant; Pneumocystis jiroveci was uncommon infection before the AIDS epidemic. Pneumocystis pneumonia in people with AIDS usually develops gradually over days to weeks or even months, and is less serious. People with pneumocystis pneumonia who do not have AIDS usually get ill much faster and are more significantly ill.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
69539 | C11H17NO2S | 227.33 | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)C | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)C | InChI=1S/C11H17NO2S/c1-4-12(5-2)15(13,14)11-8-6-10(3)7-9-11/h6-9H,4-5H2,1-3H3 | AOJBACHWNDMRQP-UHFFFAOYSA-N | N,N-diethyl-4-methylbenzenesulfonamide | 2.2 | 227.09799996 | 227.09799996 | 45.8 | 270 | 0 | 0 | 3 | 4 | 15 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.