Penbutolol is used alone or together with other medications, consisting of a diuretic or "water pill" such as hydrochlorothiazide to treat high blood pressure. The heart and arteries might not function appropriately if it continues for a long time. High blood pressure may also increase the risk of heart attacks. These problems might be less likely to occur if blood pressure is controlled. Therefore, the heart defeats slower and decreases the high blood pressure. When the blood pressure is decreased, the quantity of blood and oxygen is increased to the heart. This medication is readily available only with your doctor's prescription.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
https://www.mayoclinic.org/drugs-supplements/penbutolol-oral-route/description/drg-2007497...
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
37464 | C18H29NO2 | 291.4 | CC(C)(C)NCC(COC1=CC=CC=C1C2CCCC2)O | CC(C)(C)NC[[email protected]@H](COC1=CC=CC=C1C2CCCC2)O | InChI=1S/C18H29NO2/c1-18(2,3)19-12-15(20)13-21-17-11-7-6-10-16(17)14-8-4-5-9-14/h6-7,10-11,14-15,19-20H,4-5,8-9,12-13H2,1-3H3/t15-/m0/s1 | KQXKVJAGOJTNJS-HNNXBMFYSA-N | (2S)-1-(tert-butylamino)-3-(2-cyclopentylphenoxy)propan-2-ol | 4.2 | 291.219829168 | 291.219829168 | 41.5 | 294 | 0 | 2 | 3 | 7 | 21 | 0 | 1 | 1 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.