A retrovirus is a virus that uses RNA as its genomic material. Upon infection with a retrovirus, a cell converts the retroviral RNA into DNA, which subsequently is inserted into the DNA of the host cell. The cell then generates more retroviruses, which contaminate other cells. Additionally, scientists have found that retroviruses could be practically half a billion years of ages.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
35370 | C10H13N5O4 | 267.24 | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)N=[N+]=[N-] | CC1=CN(C(=O)NC1=O)[[email protected]]2C[[email protected]@H]([[email protected]](O2)CO)N=[N+]=[N-] | InChI=1S/C10H13N5O4/c1-5-3-15(10(18)12-9(5)17)8-2-6(13-14-11)7(4-16)19-8/h3,6-8,16H,2,4H2,1H3,(H,12,17,18)/t6-,7+,8+/m0/s1 | HBOMLICNUCNMMY-XLPZGREQSA-N | 1-[(2R,4S,5S)-4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione | 0 | 267.09675391 | 267.09675391 | 93.2 | 484 | 0 | 2 | 6 | 3 | 19 | 0 | 3 | 3 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.