Get the most up to date public health information from CDC and research details from NIH. Federal government internet sites usually end in. gov or. mil. Prior to sharing delicate details, make sure you're on a federal government website. Adverse, Male, Rats; Negative, Female, Rats; Negative, Male, Mice; Negative, Female, Mice. Chemical Effects in Biological Systems. Research Triangle Park, NC: National Toxicology Program.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
5505 | C12H18N2O3S | 270.35 | CCCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)C | CCCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)C | InChI=1S/C12H18N2O3S/c1-3-4-9-13-12(15)14-18(16,17)11-7-5-10(2)6-8-11/h5-8H,3-4,9H2,1-2H3,(H2,13,14,15) | JLRGJRBPOGGCBT-UHFFFAOYSA-N | 1-butyl-3-(4-methylphenyl)sulfonylurea | 2.3 | 270.10381361 | 270.10381361 | 83.6 | 354 | 0 | 2 | 3 | 5 | 18 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.