Chemically, trimethobenzamide hydrochloride is N- [- [2-ethoxy] benzyl] - 3,4,5-trimethoxybenzamide monohydrochloride. Each pill for oral use includes trimethobenzamide hydrochloride equal to 300 mg. Inactive Ingredients: Lactose monohydrate, magnesium stearate and pregelatinized starch. The pill covering has the following active ingredients: D&C Red # 28, FD&C Blue # 1, FD&C Red # 40, gelatin and titanium dioxide.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=8ccb7a57-a1e4-55f7-e053-2a95a90a7...
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
5577 | C21H28N2O5 | 388.5 | CN(C)CCOC1=CC=C(C=C1)CNC(=O)C2=CC(=C(C(=C2)OC)OC)OC | CN(C)CCOC1=CC=C(C=C1)CNC(=O)C2=CC(=C(C(=C2)OC)OC)OC | InChI=1S/C21H28N2O5/c1-23(2)10-11-28-17-8-6-15(7-9-17)14-22-21(24)16-12-18(25-3)20(27-5)19(13-16)26-4/h6-9,12-13H,10-11,14H2,1-5H3,(H,22,24) | FEZBIKUBAYAZIU-UHFFFAOYSA-N | N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4,5-trimethoxybenzamide | 2.3 | 388.19982200 | 388.19982200 | 69.3 | 440 | 0 | 1 | 6 | 10 | 28 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.