It's used to treat and avoid urinary tract infections, such as cystitis. You can drink alcohol while taking trimethoprim. Tell your medical professional if you do not start feeling better after taking trimethoprim for 3 days, or if you begin to feel worse any time. To ensure this medicine is safe for you, inform your doctor if you: have ever before had an allergy to trimethoprim or any other medicine; have liver or kidney issues; have anaemia or low amounts of folic acid in your blood; have porphyria or any other blood disorder; are trying to get pregnant or are already pregnant.
* Please keep in mind that all text is summarized by machine, we do not bear any responsibility, and you should always check original source before taking any actions
** If you believe that content on the Plex is summarised improperly, please, contact us, and we will get rid of it quickly; please, send an email with a brief explanation.
CID | MolecularFormula | MolecularWeight | CanonicalSMILES | IsomericSMILES | InChI | InChIKey | IUPACName | XLogP | ExactMass | MonoisotopicMass | TPSA | Complexity | Charge | HBondDonorCount | HBondAcceptorCount | RotatableBondCount | HeavyAtomCount | IsotopeAtomCount | AtomStereoCount | DefinedAtomStereoCount | UndefinedAtomStereoCount | BondStereoCount | DefinedBondStereoCount | UndefinedBondStereoCount | CovalentUnitCount |
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
5578 | C14H18N4O3 | 290.32 | COC1=CC(=CC(=C1OC)OC)CC2=CN=C(N=C2N)N | COC1=CC(=CC(=C1OC)OC)CC2=CN=C(N=C2N)N | InChI=1S/C14H18N4O3/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-17-14(16)18-13(9)15/h5-7H,4H2,1-3H3,(H4,15,16,17,18) | IEDVJHCEMCRBQM-UHFFFAOYSA-N | 5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine | 0.9 | 290.13789045 | 290.13789045 | 106 | 307 | 0 | 2 | 7 | 5 | 21 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 1 |
Plex Page is a Biology & Health Sciences "Online Knowledge Base," where a machine summarizes all the summaries.